C37H54ClNO5Si2 — CID 59578300
(4R,6E,10E,12E)-16,18-bis[[tert-butyl(dimethyl)silyl]oxy]-15-chloro-4-methyl-12-phenylmethoxyimino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one (PubChem CID 59578300) has the molecular formula C37H54ClNO5Si2 and a molecular weight of 684.47 g/mol. Its IUPAC name is (4R,6E,10E,12E)-16,18-bis[[tert-butyl(dimethyl)silyl]oxy]-15-chloro-4-methyl-12-phenylmethoxyimino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one.
| Compound Name | (4R,6E,10E,12E)-16,18-bis[[tert-butyl(dimethyl)silyl]oxy]-15-chloro-4-methyl-12-phenylmethoxyimino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
|---|---|
| PubChem CID | 59578300 |
| Molecular Formula | C37H54ClNO5Si2 |
| Molecular Weight | 684.47 g/mol |
| Exact Mass | 683.32 |
| IUPAC Name | (4R,6E,10E,12E)-16,18-bis[[tert-butyl(dimethyl)silyl]oxy]-15-chloro-4-methyl-12-phenylmethoxyimino-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,15,17-pentaen-2-one |
| SMILES | C[C@@H]1C/C=C/CC/C=C/C(=N/OCc2ccccc2)Cc2c(Cl)c(O[Si](C)(C)C(C)(C)C)cc(O[Si](C)(C)C(C)(C)C)c2C(=O)O1 |
| InChI | InChI=1S/C37H54ClNO5Si2/c1-27-20-16-13-12-14-19-23-29(39-41-26-28-21-17-15-18-22-28)24-30-33(35(40)42-27)31(43-45(8,9)36(2,3)4)25-32(34(30)38)44-46(10,11)37(5,6)7/h13,15-19,21-23,25,27H,12,14,20,24,26H2,1-11H3/b16-13+,23-19+,39-29-/t27-/m1/s1 |
| InChIKey | NOXJDNKBSDQMOR-PRIWGFOVSA-N |
| XLogP | 11.06 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.47 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|