C26H23F3O5 — CID 59578317
(4S,6E,10E,12E)-16,18-dihydroxy-4-phenyl-12-(3,3,3-trifluoro-2-oxopropyl)-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one (PubChem CID 59578317) has the molecular formula C26H23F3O5 and a molecular weight of 472.46 g/mol. Its IUPAC name is (4S,6E,10E,12E)-16,18-dihydroxy-4-phenyl-12-(3,3,3-trifluoro-2-oxopropyl)-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one.
| Compound Name | (4S,6E,10E,12E)-16,18-dihydroxy-4-phenyl-12-(3,3,3-trifluoro-2-oxopropyl)-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one |
|---|---|
| PubChem CID | 59578317 |
| Molecular Formula | C26H23F3O5 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | (4S,6E,10E,12E)-16,18-dihydroxy-4-phenyl-12-(3,3,3-trifluoro-2-oxopropyl)-3-oxabicyclo[12.4.0]octadeca-1(14),6,10,12,15,17-hexaen-2-one |
| SMILES | O=C1O[C@H](c2ccccc2)C/C=C/CC/C=C/C(CC(=O)C(F)(F)F)=C/c2cc(O)cc(O)c21 |
| InChI | InChI=1S/C26H23F3O5/c27-26(28,29)23(32)14-17-9-5-2-1-3-8-12-22(18-10-6-4-7-11-18)34-25(33)24-19(13-17)15-20(30)16-21(24)31/h3-11,13,15-16,22,30-31H,1-2,12,14H2/b8-3+,9-5+,17-13-/t22-/m0/s1 |
| InChIKey | ZCQXPBQXXGJDMK-XPIBVBMXSA-N |
| XLogP | 6.20 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|