C11H18BNO4 — CID 59578349
[(3S,3aS,6aR)-3-ethoxycarbonyl-6-oxo-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-methylborinic acid (PubChem CID 59578349) has the molecular formula C11H18BNO4 and a molecular weight of 239.08 g/mol. Its IUPAC name is [(3S,3aS,6aR)-3-ethoxycarbonyl-6-oxo-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-methylborinic acid.
| Compound Name | [(3S,3aS,6aR)-3-ethoxycarbonyl-6-oxo-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-methylborinic acid |
|---|---|
| PubChem CID | 59578349 |
| Molecular Formula | C11H18BNO4 |
| Molecular Weight | 239.08 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | [(3S,3aS,6aR)-3-ethoxycarbonyl-6-oxo-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-methylborinic acid |
| SMILES | CCOC(=O)[C@@H]1[C@H]2CCC(=O)[C@H]2CN1B(C)O |
| InChI | InChI=1S/C11H18BNO4/c1-3-17-11(15)10-7-4-5-9(14)8(7)6-13(10)12(2)16/h7-8,10,16H,3-6H2,1-2H3/t7-,8-,10-/m0/s1 |
| InChIKey | DCDZPGORGNOTDM-NRPADANISA-N |
| XLogP | -0.06 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.08 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|