About 2-bromo-1,3-difluoro-5-propan-2-ylbenzene
2-bromo-1,3-difluoro-5-propan-2-ylbenzene (PubChem CID 59578546) has the molecular formula C9H9BrF2
and a molecular weight of 235.07 g/mol. Its IUPAC name is 2-bromo-1,3-difluoro-5-propan-2-ylbenzene.
Molecular Properties
| Compound Name | 2-bromo-1,3-difluoro-5-propan-2-ylbenzene |
| PubChem CID | 59578546 |
| Molecular Formula | C9H9BrF2 |
| Molecular Weight | 235.07 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | 2-bromo-1,3-difluoro-5-propan-2-ylbenzene |
| SMILES | CC(C)c1cc(F)c(Br)c(F)c1 |
| InChI | InChI=1S/C9H9BrF2/c1-5(2)6-3-7(11)9(10)8(12)4-6/h3-5H,1-2H3 |
| InChIKey | IJHRAXVCIHLTFO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.07 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1,3-difluoro-5-propan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,3-difluoro-5-propan-2-ylbenzene?
The IUPAC name of 2-bromo-1,3-difluoro-5-propan-2-ylbenzene (CID 59578546) is 2-bromo-1,3-difluoro-5-propan-2-ylbenzene.
What is the SMILES notation for 2-bromo-1,3-difluoro-5-propan-2-ylbenzene?
The canonical SMILES for 2-bromo-1,3-difluoro-5-propan-2-ylbenzene is CC(C)c1cc(F)c(Br)c(F)c1.
What is the InChIKey of 2-bromo-1,3-difluoro-5-propan-2-ylbenzene?
The InChIKey is IJHRAXVCIHLTFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrF2/c1-5(2)6-3-7(11)9(10)8(12)4-6/h3-5H,1-2H3.
What are the key properties of 2-bromo-1,3-difluoro-5-propan-2-ylbenzene?
2-bromo-1,3-difluoro-5-propan-2-ylbenzene has a molecular weight of 235.07 g/mol, XLogP of 3.85, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,3-difluoro-5-propan-2-ylbenzene is sourced from PubChem (CID 59578546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).