C21H21ClN2O3 — CID 59579428
3-(4-chlorophenyl)-N-[2-(2-methoxyethyl)-1-oxoisoquinolin-5-yl]propanamide (PubChem CID 59579428) has the molecular formula C21H21ClN2O3 and a molecular weight of 384.86 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[2-(2-methoxyethyl)-1-oxoisoquinolin-5-yl]propanamide.
| Compound Name | 3-(4-chlorophenyl)-N-[2-(2-methoxyethyl)-1-oxoisoquinolin-5-yl]propanamide |
|---|---|
| PubChem CID | 59579428 |
| Molecular Formula | C21H21ClN2O3 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[2-(2-methoxyethyl)-1-oxoisoquinolin-5-yl]propanamide |
| SMILES | COCCn1ccc2c(NC(=O)CCc3ccc(Cl)cc3)cccc2c1=O |
| InChI | InChI=1S/C21H21ClN2O3/c1-27-14-13-24-12-11-17-18(21(24)26)3-2-4-19(17)23-20(25)10-7-15-5-8-16(22)9-6-15/h2-6,8-9,11-12H,7,10,13-14H2,1H3,(H,23,25) |
| InChIKey | VMQLYIDFGXDHHY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |