C25H19F3N2O3 — CID 59579585
3-methyl-N-[1-oxo-2-[[4-(trifluoromethoxy)phenyl]methyl]isoquinolin-5-yl]benzamide (PubChem CID 59579585) has the molecular formula C25H19F3N2O3 and a molecular weight of 452.43 g/mol. Its IUPAC name is 3-methyl-N-[1-oxo-2-[[4-(trifluoromethoxy)phenyl]methyl]isoquinolin-5-yl]benzamide.
| Compound Name | 3-methyl-N-[1-oxo-2-[[4-(trifluoromethoxy)phenyl]methyl]isoquinolin-5-yl]benzamide |
|---|---|
| PubChem CID | 59579585 |
| Molecular Formula | C25H19F3N2O3 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 3-methyl-N-[1-oxo-2-[[4-(trifluoromethoxy)phenyl]methyl]isoquinolin-5-yl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2cccc3c(=O)n(Cc4ccc(OC(F)(F)F)cc4)ccc23)c1 |
| InChI | InChI=1S/C25H19F3N2O3/c1-16-4-2-5-18(14-16)23(31)29-22-7-3-6-21-20(22)12-13-30(24(21)32)15-17-8-10-19(11-9-17)33-25(26,27)28/h2-14H,15H2,1H3,(H,29,31) |
| InChIKey | OELQNZVZEQSGOO-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |