C21H25BrN6O4S — CID 59580989
(2S)-1-[4-[2-[6-amino-8-(2-bromo-4,5-dihydroxyphenyl)sulfanylpurin-9-yl]ethyl]piperidin-1-yl]-2-hydroxypropan-1-one (PubChem CID 59580989) has the molecular formula C21H25BrN6O4S and a molecular weight of 537.44 g/mol. Its IUPAC name is (2S)-1-[4-[2-[6-amino-8-(2-bromo-4,5-dihydroxyphenyl)sulfanylpurin-9-yl]ethyl]piperidin-1-yl]-2-hydroxypropan-1-one.
| Compound Name | (2S)-1-[4-[2-[6-amino-8-(2-bromo-4,5-dihydroxyphenyl)sulfanylpurin-9-yl]ethyl]piperidin-1-yl]-2-hydroxypropan-1-one |
|---|---|
| PubChem CID | 59580989 |
| Molecular Formula | C21H25BrN6O4S |
| Molecular Weight | 537.44 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | (2S)-1-[4-[2-[6-amino-8-(2-bromo-4,5-dihydroxyphenyl)sulfanylpurin-9-yl]ethyl]piperidin-1-yl]-2-hydroxypropan-1-one |
| SMILES | C[C@H](O)C(=O)N1CCC(CCn2c(Sc3cc(O)c(O)cc3Br)nc3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C21H25BrN6O4S/c1-11(29)20(32)27-5-2-12(3-6-27)4-7-28-19-17(18(23)24-10-25-19)26-21(28)33-16-9-15(31)14(30)8-13(16)22/h8-12,29-31H,2-7H2,1H3,(H2,23,24,25)/t11-/m0/s1 |
| InChIKey | FXZKJUJNIOBEDS-NSHDSACASA-N |
| XLogP | 2.74 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|