About tert-butyl 4-(1,3-oxazole-2-carbonyl)piperidine-1-carboxylate
tert-butyl 4-(1,3-oxazole-2-carbonyl)piperidine-1-carboxylate (PubChem CID 59581365) has the molecular formula C14H20N2O4
and a molecular weight of 280.32 g/mol. Its IUPAC name is tert-butyl 4-(1,3-oxazole-2-carbonyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-(1,3-oxazole-2-carbonyl)piperidine-1-carboxylate |
| PubChem CID | 59581365 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | tert-butyl 4-(1,3-oxazole-2-carbonyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)c2ncco2)CC1 |
| InChI | InChI=1S/C14H20N2O4/c1-14(2,3)20-13(18)16-7-4-10(5-8-16)11(17)12-15-6-9-19-12/h6,9-10H,4-5,7-8H2,1-3H3 |
| InChIKey | XOKJWBRMJFHQEZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-(1,3-oxazole-2-carbonyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(1,3-oxazole-2-carbonyl)piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-(1,3-oxazole-2-carbonyl)piperidine-1-carboxylate (CID 59581365) is tert-butyl 4-(1,3-oxazole-2-carbonyl)piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-(1,3-oxazole-2-carbonyl)piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-(1,3-oxazole-2-carbonyl)piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(C(=O)c2ncco2)CC1.
What is the InChIKey of tert-butyl 4-(1,3-oxazole-2-carbonyl)piperidine-1-carboxylate?
The InChIKey is XOKJWBRMJFHQEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O4/c1-14(2,3)20-13(18)16-7-4-10(5-8-16)11(17)12-15-6-9-19-12/h6,9-10H,4-5,7-8H2,1-3H3.
What are the key properties of tert-butyl 4-(1,3-oxazole-2-carbonyl)piperidine-1-carboxylate?
tert-butyl 4-(1,3-oxazole-2-carbonyl)piperidine-1-carboxylate has a molecular weight of 280.32 g/mol, XLogP of 2.50, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(1,3-oxazole-2-carbonyl)piperidine-1-carboxylate is sourced from PubChem (CID 59581365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).