About (1-methylpiperidin-4-yl)-(1,3-oxazol-2-yl)methanone
(1-methylpiperidin-4-yl)-(1,3-oxazol-2-yl)methanone (PubChem CID 59581367) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl)-(1,3-oxazol-2-yl)methanone.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl)-(1,3-oxazol-2-yl)methanone |
| PubChem CID | 59581367 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (1-methylpiperidin-4-yl)-(1,3-oxazol-2-yl)methanone |
| SMILES | CN1CCC(C(=O)c2ncco2)CC1 |
| InChI | InChI=1S/C10H14N2O2/c1-12-5-2-8(3-6-12)9(13)10-11-4-7-14-10/h4,7-8H,2-3,5-6H2,1H3 |
| InChIKey | NWUKXJJCAOBKSF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-methylpiperidin-4-yl)-(1,3-oxazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl)-(1,3-oxazol-2-yl)methanone?
The IUPAC name of (1-methylpiperidin-4-yl)-(1,3-oxazol-2-yl)methanone (CID 59581367) is (1-methylpiperidin-4-yl)-(1,3-oxazol-2-yl)methanone.
What is the SMILES notation for (1-methylpiperidin-4-yl)-(1,3-oxazol-2-yl)methanone?
The canonical SMILES for (1-methylpiperidin-4-yl)-(1,3-oxazol-2-yl)methanone is CN1CCC(C(=O)c2ncco2)CC1.
What is the InChIKey of (1-methylpiperidin-4-yl)-(1,3-oxazol-2-yl)methanone?
The InChIKey is NWUKXJJCAOBKSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-12-5-2-8(3-6-12)9(13)10-11-4-7-14-10/h4,7-8H,2-3,5-6H2,1H3.
What are the key properties of (1-methylpiperidin-4-yl)-(1,3-oxazol-2-yl)methanone?
(1-methylpiperidin-4-yl)-(1,3-oxazol-2-yl)methanone has a molecular weight of 194.23 g/mol, XLogP of 1.20, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl)-(1,3-oxazol-2-yl)methanone is sourced from PubChem (CID 59581367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).