C14H11F3N2O4 — CID 59581489
[4-[[5-(2,2,2-trifluoroethyl)-1,2-oxazol-3-yl]carbamoyl]phenyl] acetate (PubChem CID 59581489) has the molecular formula C14H11F3N2O4 and a molecular weight of 328.25 g/mol. Its IUPAC name is [4-[[5-(2,2,2-trifluoroethyl)-1,2-oxazol-3-yl]carbamoyl]phenyl] acetate.
| Compound Name | [4-[[5-(2,2,2-trifluoroethyl)-1,2-oxazol-3-yl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 59581489 |
| Molecular Formula | C14H11F3N2O4 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | [4-[[5-(2,2,2-trifluoroethyl)-1,2-oxazol-3-yl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)Nc2cc(CC(F)(F)F)on2)cc1 |
| InChI | InChI=1S/C14H11F3N2O4/c1-8(20)22-10-4-2-9(3-5-10)13(21)18-12-6-11(23-19-12)7-14(15,16)17/h2-6H,7H2,1H3,(H,18,19,21) |
| InChIKey | KVCALEURMRPFGQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|