C14H13F3N4O3 — CID 59581591
[3-methyl-5-[[2-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]carbamoyl]phenyl] acetate (PubChem CID 59581591) has the molecular formula C14H13F3N4O3 and a molecular weight of 342.28 g/mol. Its IUPAC name is [3-methyl-5-[[2-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]carbamoyl]phenyl] acetate.
| Compound Name | [3-methyl-5-[[2-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 59581591 |
| Molecular Formula | C14H13F3N4O3 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | [3-methyl-5-[[2-methyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(C)cc(C(=O)Nc2nc(C(F)(F)F)nn2C)c1 |
| InChI | InChI=1S/C14H13F3N4O3/c1-7-4-9(6-10(5-7)24-8(2)22)11(23)18-13-19-12(14(15,16)17)20-21(13)3/h4-6H,1-3H3,(H,18,19,20,23) |
| InChIKey | SVTQJCFOXFTCEC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|