C25H27F2N3OS — CID 59581687
methyl 4-[4-[(2,6-difluorophenyl)methyl]-1,3-thiazol-2-yl]-N-(2,5-dimethylphenyl)piperidine-1-carboximidate (PubChem CID 59581687) has the molecular formula C25H27F2N3OS and a molecular weight of 455.57 g/mol. Its IUPAC name is methyl 4-[4-[(2,6-difluorophenyl)methyl]-1,3-thiazol-2-yl]-N-(2,5-dimethylphenyl)piperidine-1-carboximidate.
| Compound Name | methyl 4-[4-[(2,6-difluorophenyl)methyl]-1,3-thiazol-2-yl]-N-(2,5-dimethylphenyl)piperidine-1-carboximidate |
|---|---|
| PubChem CID | 59581687 |
| Molecular Formula | C25H27F2N3OS |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | methyl 4-[4-[(2,6-difluorophenyl)methyl]-1,3-thiazol-2-yl]-N-(2,5-dimethylphenyl)piperidine-1-carboximidate |
| SMILES | CO/C(=N\c1cc(C)ccc1C)N1CCC(c2nc(Cc3c(F)cccc3F)cs2)CC1 |
| InChI | InChI=1S/C25H27F2N3OS/c1-16-7-8-17(2)23(13-16)29-25(31-3)30-11-9-18(10-12-30)24-28-19(15-32-24)14-20-21(26)5-4-6-22(20)27/h4-8,13,15,18H,9-12,14H2,1-3H3/b29-25- |
| InChIKey | ACYSUEKVSVQYBI-GNVQSUKOSA-N |
| XLogP | 6.14 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|