C26H29F2N3OS — CID 59581696
methyl 4-[4-[2-(2,6-difluorophenyl)ethyl]-1,3-thiazol-2-yl]-N-(2,5-dimethylphenyl)piperidine-1-carboximidate (PubChem CID 59581696) has the molecular formula C26H29F2N3OS and a molecular weight of 469.60 g/mol. Its IUPAC name is methyl 4-[4-[2-(2,6-difluorophenyl)ethyl]-1,3-thiazol-2-yl]-N-(2,5-dimethylphenyl)piperidine-1-carboximidate.
| Compound Name | methyl 4-[4-[2-(2,6-difluorophenyl)ethyl]-1,3-thiazol-2-yl]-N-(2,5-dimethylphenyl)piperidine-1-carboximidate |
|---|---|
| PubChem CID | 59581696 |
| Molecular Formula | C26H29F2N3OS |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | methyl 4-[4-[2-(2,6-difluorophenyl)ethyl]-1,3-thiazol-2-yl]-N-(2,5-dimethylphenyl)piperidine-1-carboximidate |
| SMILES | CO/C(=N\c1cc(C)ccc1C)N1CCC(c2nc(CCc3c(F)cccc3F)cs2)CC1 |
| InChI | InChI=1S/C26H29F2N3OS/c1-17-7-8-18(2)24(15-17)30-26(32-3)31-13-11-19(12-14-31)25-29-20(16-33-25)9-10-21-22(27)5-4-6-23(21)28/h4-8,15-16,19H,9-14H2,1-3H3/b30-26- |
| InChIKey | BVLCPCKGHMUDAA-BXVZCJGGSA-N |
| XLogP | 6.34 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|