C48H28F9N3O3 — CID 59582206
3-N,6-N-diphenyl-3-N,6-N,9-tris[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole-3,6-diamine (PubChem CID 59582206) has the molecular formula C48H28F9N3O3 and a molecular weight of 865.75 g/mol. Its IUPAC name is 3-N,6-N-diphenyl-3-N,6-N,9-tris[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole-3,6-diamine.
| Compound Name | 3-N,6-N-diphenyl-3-N,6-N,9-tris[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole-3,6-diamine |
|---|---|
| PubChem CID | 59582206 |
| Molecular Formula | C48H28F9N3O3 |
| Molecular Weight | 865.75 g/mol |
| Exact Mass | 865.20 |
| IUPAC Name | 3-N,6-N-diphenyl-3-N,6-N,9-tris[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole-3,6-diamine |
| SMILES | FC(F)=C(F)Oc1ccc(N(c2ccccc2)c2ccc3c(c2)c2cc(N(c4ccccc4)c4ccc(OC(F)=C(F)F)cc4)ccc2n3-c2ccc(OC(F)=C(F)F)cc2)cc1 |
| InChI | InChI=1S/C48H28F9N3O3/c49-43(50)46(55)61-36-19-11-31(12-20-36)58(29-7-3-1-4-8-29)34-17-25-41-39(27-34)40-28-35(18-26-42(40)60(41)33-15-23-38(24-16-33)63-48(57)45(53)54)59(30-9-5-2-6-10-30)32-13-21-37(22-14-32)62-47(56)44(51)52/h1-28H |
| InChIKey | LHYXZUHWGYAHMG-UHFFFAOYSA-N |
| XLogP | 15.97 |
| TPSA | 39.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.75 |
| LogP ≤ 5 | 15.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|