About 9-phenyl-3,6-bis[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole
9-phenyl-3,6-bis[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole (PubChem CID 59582224) has the molecular formula C34H19F6NO2
and a molecular weight of 587.52 g/mol. Its IUPAC name is 9-phenyl-3,6-bis[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole.
Molecular Properties
| Compound Name | 9-phenyl-3,6-bis[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole |
| PubChem CID | 59582224 |
| Molecular Formula | C34H19F6NO2 |
| Molecular Weight | 587.52 g/mol |
| Exact Mass | 587.13 |
| IUPAC Name | 9-phenyl-3,6-bis[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole |
| SMILES | FC(F)=C(F)Oc1ccc(-c2ccc3c(c2)c2cc(-c4ccc(OC(F)=C(F)F)cc4)ccc2n3-c2ccccc2)cc1 |
| InChI | InChI=1S/C34H19F6NO2/c35-31(36)33(39)42-25-12-6-20(7-13-25)22-10-16-29-27(18-22)28-19-23(11-17-30(28)41(29)24-4-2-1-3-5-24)21-8-14-26(15-9-21)43-34(40)32(37)38/h1-19H |
| InChIKey | QVKFAZDMPQJXNF-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 587.52 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 9-phenyl-3,6-bis[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-phenyl-3,6-bis[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole?
The IUPAC name of 9-phenyl-3,6-bis[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole (CID 59582224) is 9-phenyl-3,6-bis[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole.
What is the SMILES notation for 9-phenyl-3,6-bis[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole?
The canonical SMILES for 9-phenyl-3,6-bis[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole is FC(F)=C(F)Oc1ccc(-c2ccc3c(c2)c2cc(-c4ccc(OC(F)=C(F)F)cc4)ccc2n3-c2ccccc2)cc1.
What is the InChIKey of 9-phenyl-3,6-bis[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole?
The InChIKey is QVKFAZDMPQJXNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H19F6NO2/c35-31(36)33(39)42-25-12-6-20(7-13-25)22-10-16-29-27(18-22)28-19-23(11-17-30(28)41(29)24-4-2-1-3-5-24)21-8-14-26(15-9-21)43-34(40)32(37)38/h1-19H.
What are the key properties of 9-phenyl-3,6-bis[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole?
9-phenyl-3,6-bis[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole has a molecular weight of 587.52 g/mol, XLogP of 10.95, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-phenyl-3,6-bis[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole is sourced from PubChem (CID 59582224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).