C46H29F6N3O2 — CID 59582226
3-N,6-N,9-triphenyl-3-N,6-N-bis[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole-3,6-diamine (PubChem CID 59582226) has the molecular formula C46H29F6N3O2 and a molecular weight of 769.75 g/mol. Its IUPAC name is 3-N,6-N,9-triphenyl-3-N,6-N-bis[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole-3,6-diamine.
| Compound Name | 3-N,6-N,9-triphenyl-3-N,6-N-bis[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole-3,6-diamine |
|---|---|
| PubChem CID | 59582226 |
| Molecular Formula | C46H29F6N3O2 |
| Molecular Weight | 769.75 g/mol |
| Exact Mass | 769.22 |
| IUPAC Name | 3-N,6-N,9-triphenyl-3-N,6-N-bis[4-(1,2,2-trifluoroethenoxy)phenyl]carbazole-3,6-diamine |
| SMILES | FC(F)=C(F)Oc1ccc(N(c2ccccc2)c2ccc3c(c2)c2cc(N(c4ccccc4)c4ccc(OC(F)=C(F)F)cc4)ccc2n3-c2ccccc2)cc1 |
| InChI | InChI=1S/C46H29F6N3O2/c47-43(48)45(51)56-37-22-16-33(17-23-37)53(30-10-4-1-5-11-30)35-20-26-41-39(28-35)40-29-36(21-27-42(40)55(41)32-14-8-3-9-15-32)54(31-12-6-2-7-13-31)34-18-24-38(25-19-34)57-46(52)44(49)50/h1-29H |
| InChIKey | NRQOHEDPDYTTSM-UHFFFAOYSA-N |
| XLogP | 14.55 |
| TPSA | 29.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.75 |
| LogP ≤ 5 | 14.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|