C10H14N6O6 — CID 59582246
methyl N-[4,6-bis(methoxycarbonylamino)-1,3,5-triazin-2-yl]-N-methylcarbamate (PubChem CID 59582246) has the molecular formula C10H14N6O6 and a molecular weight of 314.26 g/mol. Its IUPAC name is methyl N-[4,6-bis(methoxycarbonylamino)-1,3,5-triazin-2-yl]-N-methylcarbamate.
| Compound Name | methyl N-[4,6-bis(methoxycarbonylamino)-1,3,5-triazin-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 59582246 |
| Molecular Formula | C10H14N6O6 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | methyl N-[4,6-bis(methoxycarbonylamino)-1,3,5-triazin-2-yl]-N-methylcarbamate |
| SMILES | COC(=O)Nc1nc(NC(=O)OC)nc(N(C)C(=O)OC)n1 |
| InChI | InChI=1S/C10H14N6O6/c1-16(10(19)22-4)7-12-5(14-8(17)20-2)11-6(13-7)15-9(18)21-3/h1-4H3,(H2,11,12,13,14,15,17,18) |
| InChIKey | YIGHLZQORKBELE-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|