C9H16OS — CID 59582664
2,2-dimethyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]oxathiole (PubChem CID 59582664) has the molecular formula C9H16OS and a molecular weight of 172.29 g/mol. Its IUPAC name is 2,2-dimethyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]oxathiole.
| Compound Name | 2,2-dimethyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]oxathiole |
|---|---|
| PubChem CID | 59582664 |
| Molecular Formula | C9H16OS |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 2,2-dimethyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]oxathiole |
| SMILES | CC1(C)OC2CCCCC2S1 |
| InChI | InChI=1S/C9H16OS/c1-9(2)10-7-5-3-4-6-8(7)11-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | FTTWADPRXFEKIX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |