About 2-isocyano-3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enenitrile
2-isocyano-3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enenitrile (PubChem CID 59582757) has the molecular formula C18H8F6N2
and a molecular weight of 366.26 g/mol. Its IUPAC name is 2-isocyano-3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enenitrile.
Molecular Properties
| Compound Name | 2-isocyano-3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enenitrile |
| PubChem CID | 59582757 |
| Molecular Formula | C18H8F6N2 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2-isocyano-3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enenitrile |
| SMILES | [C-]#[N+]C(C#N)=C(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H8F6N2/c1-26-15(10-25)16(11-4-2-6-13(8-11)17(19,20)21)12-5-3-7-14(9-12)18(22,23)24/h2-9H |
| InChIKey | UGUHSMBKRJNVDK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyano-3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyano-3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enenitrile?
The IUPAC name of 2-isocyano-3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enenitrile (CID 59582757) is 2-isocyano-3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enenitrile.
What is the SMILES notation for 2-isocyano-3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enenitrile?
The canonical SMILES for 2-isocyano-3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enenitrile is [C-]#[N+]C(C#N)=C(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1.
What is the InChIKey of 2-isocyano-3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enenitrile?
The InChIKey is UGUHSMBKRJNVDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H8F6N2/c1-26-15(10-25)16(11-4-2-6-13(8-11)17(19,20)21)12-5-3-7-14(9-12)18(22,23)24/h2-9H.
What are the key properties of 2-isocyano-3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enenitrile?
2-isocyano-3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enenitrile has a molecular weight of 366.26 g/mol, XLogP of 5.93, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyano-3,3-bis[3-(trifluoromethyl)phenyl]prop-2-enenitrile is sourced from PubChem (CID 59582757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).