About 2-chloro-1H-1,2-benzazaborinine
2-chloro-1H-1,2-benzazaborinine (PubChem CID 59583108) has the molecular formula C8H7BClN
and a molecular weight of 163.42 g/mol. Its IUPAC name is 2-chloro-1H-1,2-benzazaborinine.
Molecular Properties
| Compound Name | 2-chloro-1H-1,2-benzazaborinine |
| PubChem CID | 59583108 |
| Molecular Formula | C8H7BClN |
| Molecular Weight | 163.42 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 2-chloro-1H-1,2-benzazaborinine |
| SMILES | ClB1C=Cc2ccccc2N1 |
| InChI | InChI=1S/C8H7BClN/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6,11H |
| InChIKey | OXABPHKDQGRFTG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1H-1,2-benzazaborinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1H-1,2-benzazaborinine?
The IUPAC name of 2-chloro-1H-1,2-benzazaborinine (CID 59583108) is 2-chloro-1H-1,2-benzazaborinine.
What is the SMILES notation for 2-chloro-1H-1,2-benzazaborinine?
The canonical SMILES for 2-chloro-1H-1,2-benzazaborinine is ClB1C=Cc2ccccc2N1.
What is the InChIKey of 2-chloro-1H-1,2-benzazaborinine?
The InChIKey is OXABPHKDQGRFTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BClN/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6,11H.
What are the key properties of 2-chloro-1H-1,2-benzazaborinine?
2-chloro-1H-1,2-benzazaborinine has a molecular weight of 163.42 g/mol, XLogP of 2.39, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1H-1,2-benzazaborinine is sourced from PubChem (CID 59583108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).