About CID 59583339
CID 59583339 (PubChem CID 59583339) has the molecular formula C40H31B2N2O4+2
and a molecular weight of 625.32 g/mol.
Molecular Properties
| Compound Name | CID 59583339 |
| PubChem CID | 59583339 |
| Molecular Formula | C40H31B2N2O4+2 |
| Molecular Weight | 625.32 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | — |
| SMILES | O[B]Oc1ccccc1C[n+]1c2ccccc2c(-c2c3ccccc3[n+](Cc3ccccc3B(O)O)c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C40H31B2N2O4/c45-41-48-38-24-12-2-14-28(38)26-44-36-22-10-5-17-31(36)40(32-18-6-11-23-37(32)44)39-29-15-3-8-20-34(29)43(35-21-9-4-16-30(35)39)25-27-13-1-7-19-33(27)42(46)47/h1-24,45-47H,25-26H2/q+2 |
| InChIKey | PTYSCSQAQSLQNS-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 625.32 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 59583339 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59583339?
The IUPAC name of CID 59583339 (CID 59583339) is not available.
What is the SMILES notation for CID 59583339?
The canonical SMILES for CID 59583339 is O[B]Oc1ccccc1C[n+]1c2ccccc2c(-c2c3ccccc3[n+](Cc3ccccc3B(O)O)c3ccccc23)c2ccccc21.
What is the InChIKey of CID 59583339?
The InChIKey is PTYSCSQAQSLQNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H31B2N2O4/c45-41-48-38-24-12-2-14-28(38)26-44-36-22-10-5-17-31(36)40(32-18-6-11-23-37(32)44)39-29-15-3-8-20-34(29)43(35-21-9-4-16-30(35)39)25-27-13-1-7-19-33(27)42(46)47/h1-24,45-47H,25-26H2/q+2.
What are the key properties of CID 59583339?
CID 59583339 has a molecular weight of 625.32 g/mol, XLogP of 5.22, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59583339 is sourced from PubChem (CID 59583339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).