About 4,7-di(propan-2-yl)-2,3-dihydrofuro[2,3-c]pyridine
4,7-di(propan-2-yl)-2,3-dihydrofuro[2,3-c]pyridine (PubChem CID 59583797) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 4,7-di(propan-2-yl)-2,3-dihydrofuro[2,3-c]pyridine.
Molecular Properties
| Compound Name | 4,7-di(propan-2-yl)-2,3-dihydrofuro[2,3-c]pyridine |
| PubChem CID | 59583797 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 4,7-di(propan-2-yl)-2,3-dihydrofuro[2,3-c]pyridine |
| SMILES | CC(C)c1cnc(C(C)C)c2c1CCO2 |
| InChI | InChI=1S/C13H19NO/c1-8(2)11-7-14-12(9(3)4)13-10(11)5-6-15-13/h7-9H,5-6H2,1-4H3 |
| InChIKey | ZZLHVMXHOAUVCX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,7-di(propan-2-yl)-2,3-dihydrofuro[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-di(propan-2-yl)-2,3-dihydrofuro[2,3-c]pyridine?
The IUPAC name of 4,7-di(propan-2-yl)-2,3-dihydrofuro[2,3-c]pyridine (CID 59583797) is 4,7-di(propan-2-yl)-2,3-dihydrofuro[2,3-c]pyridine.
What is the SMILES notation for 4,7-di(propan-2-yl)-2,3-dihydrofuro[2,3-c]pyridine?
The canonical SMILES for 4,7-di(propan-2-yl)-2,3-dihydrofuro[2,3-c]pyridine is CC(C)c1cnc(C(C)C)c2c1CCO2.
What is the InChIKey of 4,7-di(propan-2-yl)-2,3-dihydrofuro[2,3-c]pyridine?
The InChIKey is ZZLHVMXHOAUVCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-8(2)11-7-14-12(9(3)4)13-10(11)5-6-15-13/h7-9H,5-6H2,1-4H3.
What are the key properties of 4,7-di(propan-2-yl)-2,3-dihydrofuro[2,3-c]pyridine?
4,7-di(propan-2-yl)-2,3-dihydrofuro[2,3-c]pyridine has a molecular weight of 205.30 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-di(propan-2-yl)-2,3-dihydrofuro[2,3-c]pyridine is sourced from PubChem (CID 59583797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).