C15H33N — CID 59583815
N-tert-butyl-N,2,3,3,4,4-hexamethylpentan-2-amine (PubChem CID 59583815) has the molecular formula C15H33N and a molecular weight of 227.44 g/mol. Its IUPAC name is N-tert-butyl-N,2,3,3,4,4-hexamethylpentan-2-amine.
| Compound Name | N-tert-butyl-N,2,3,3,4,4-hexamethylpentan-2-amine |
|---|---|
| PubChem CID | 59583815 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | N-tert-butyl-N,2,3,3,4,4-hexamethylpentan-2-amine |
| SMILES | CN(C(C)(C)C)C(C)(C)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H33N/c1-12(2,3)14(7,8)15(9,10)16(11)13(4,5)6/h1-11H3 |
| InChIKey | ARUWYCHLSPSUOL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |