C20H22O4 — CID 59583912
1,3,4,7,8,10-hexamethyl-5a,10b-dihydro-[1]benzofuro[2,3-b][1]benzofuran-2,9-diol (PubChem CID 59583912) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is 1,3,4,7,8,10-hexamethyl-5a,10b-dihydro-[1]benzofuro[2,3-b][1]benzofuran-2,9-diol.
| Compound Name | 1,3,4,7,8,10-hexamethyl-5a,10b-dihydro-[1]benzofuro[2,3-b][1]benzofuran-2,9-diol |
|---|---|
| PubChem CID | 59583912 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1,3,4,7,8,10-hexamethyl-5a,10b-dihydro-[1]benzofuro[2,3-b][1]benzofuran-2,9-diol |
| SMILES | Cc1c(C)c2c(c(C)c1O)C1c3c(C)c(O)c(C)c(C)c3OC1O2 |
| InChI | InChI=1S/C20H22O4/c1-7-9(3)18-13(11(5)16(7)21)15-14-12(6)17(22)8(2)10(4)19(14)24-20(15)23-18/h15,20-22H,1-6H3 |
| InChIKey | PNHNCXGZAYQGSW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |