C14H18O2 — CID 59583916
2,2,7,8-tetramethyl-5-methylidene-3,4-dihydrochromen-6-one (PubChem CID 59583916) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2,2,7,8-tetramethyl-5-methylidene-3,4-dihydrochromen-6-one.
| Compound Name | 2,2,7,8-tetramethyl-5-methylidene-3,4-dihydrochromen-6-one |
|---|---|
| PubChem CID | 59583916 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2,2,7,8-tetramethyl-5-methylidene-3,4-dihydrochromen-6-one |
| SMILES | C=C1C(=O)C(C)=C(C)C2=C1CCC(C)(C)O2 |
| InChI | InChI=1S/C14H18O2/c1-8-9(2)13-11(10(3)12(8)15)6-7-14(4,5)16-13/h3,6-7H2,1-2,4-5H3 |
| InChIKey | MCOSSRKWGVOZOB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|