C34H46F6O6 — CID 59584158
1-O-[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentan-2-yl] 7-O-(2,3,3-trimethylbutan-2-yl) 2-ethyl-4-(6-hydroxynaphthalen-2-yl)-2,6-dimethylheptanedioate (PubChem CID 59584158) has the molecular formula C34H46F6O6 and a molecular weight of 664.72 g/mol. Its IUPAC name is 1-O-[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentan-2-yl] 7-O-(2,3,3-trimethylbutan-2-yl) 2-ethyl-4-(6-hydroxynaphthalen-2-yl)-2,6-dimethylheptanedioate.
| Compound Name | 1-O-[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentan-2-yl] 7-O-(2,3,3-trimethylbutan-2-yl) 2-ethyl-4-(6-hydroxynaphthalen-2-yl)-2,6-dimethylheptanedioate |
|---|---|
| PubChem CID | 59584158 |
| Molecular Formula | C34H46F6O6 |
| Molecular Weight | 664.72 g/mol |
| Exact Mass | 664.32 |
| IUPAC Name | 1-O-[5,5,5-trifluoro-4-hydroxy-4-(trifluoromethyl)pentan-2-yl] 7-O-(2,3,3-trimethylbutan-2-yl) 2-ethyl-4-(6-hydroxynaphthalen-2-yl)-2,6-dimethylheptanedioate |
| SMILES | CCC(C)(CC(CC(C)C(=O)OC(C)(C)C(C)(C)C)c1ccc2cc(O)ccc2c1)C(=O)OC(C)CC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C34H46F6O6/c1-10-31(9,28(43)45-21(3)18-32(44,33(35,36)37)34(38,39)40)19-25(15-20(2)27(42)46-30(7,8)29(4,5)6)23-11-12-24-17-26(41)14-13-22(24)16-23/h11-14,16-17,20-21,25,41,44H,10,15,18-19H2,1-9H3 |
| InChIKey | QISYJHGSKKRSRI-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.72 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |