C9H10F9O6S3- — CID 59584253
1,1,1,4,4,4-hexafluoro-2-[methylsulfonyl(3,3,3-trifluoropropylsulfonyl)methyl]sulfonylbutane (PubChem CID 59584253) has the molecular formula C9H10F9O6S3- and a molecular weight of 481.36 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluoro-2-[methylsulfonyl(3,3,3-trifluoropropylsulfonyl)methyl]sulfonylbutane.
| Compound Name | 1,1,1,4,4,4-hexafluoro-2-[methylsulfonyl(3,3,3-trifluoropropylsulfonyl)methyl]sulfonylbutane |
|---|---|
| PubChem CID | 59584253 |
| Molecular Formula | C9H10F9O6S3- |
| Molecular Weight | 481.36 g/mol |
| Exact Mass | 480.95 |
| IUPAC Name | 1,1,1,4,4,4-hexafluoro-2-[methylsulfonyl(3,3,3-trifluoropropylsulfonyl)methyl]sulfonylbutane |
| SMILES | CS(=O)(=O)[C-](S(=O)(=O)CCC(F)(F)F)S(=O)(=O)C(CC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H10F9O6S3/c1-25(19,20)6(26(21,22)3-2-7(10,11)12)27(23,24)5(9(16,17)18)4-8(13,14)15/h5H,2-4H2,1H3/q-1 |
| InChIKey | OAUQWQMPOWLHSI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|