C9H10F7O4S2- — CID 59584260
1,2,3,4-tetrafluoro-5-[1-(trifluoromethylsulfonyl)propylsulfonyl]cyclopentane (PubChem CID 59584260) has the molecular formula C9H10F7O4S2- and a molecular weight of 379.30 g/mol. Its IUPAC name is 1,2,3,4-tetrafluoro-5-[1-(trifluoromethylsulfonyl)propylsulfonyl]cyclopentane.
| Compound Name | 1,2,3,4-tetrafluoro-5-[1-(trifluoromethylsulfonyl)propylsulfonyl]cyclopentane |
|---|---|
| PubChem CID | 59584260 |
| Molecular Formula | C9H10F7O4S2- |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | 1,2,3,4-tetrafluoro-5-[1-(trifluoromethylsulfonyl)propylsulfonyl]cyclopentane |
| SMILES | CC[C-](S(=O)(=O)C1C(F)C(F)C(F)C1F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H10F7O4S2/c1-2-3(22(19,20)9(14,15)16)21(17,18)8-6(12)4(10)5(11)7(8)13/h4-8H,2H2,1H3/q-1 |
| InChIKey | YMJXUTVAKROOHB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|