C9H9F8O6S3- — CID 59584298
1,2,3,4,5-pentafluoro-6-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonylcyclohexane (PubChem CID 59584298) has the molecular formula C9H9F8O6S3- and a molecular weight of 461.35 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonylcyclohexane.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonylcyclohexane |
|---|---|
| PubChem CID | 59584298 |
| Molecular Formula | C9H9F8O6S3- |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 460.94 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonylcyclohexane |
| SMILES | CS(=O)(=O)[C-](S(=O)(=O)C1C(F)C(F)C(F)C(F)C1F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H9F8O6S3/c1-24(18,19)8(26(22,23)9(15,16)17)25(20,21)7-5(13)3(11)2(10)4(12)6(7)14/h2-7H,1H3/q-1 |
| InChIKey | XYGHGZLVNXXHDV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|