C9H7F12O6S3- — CID 59584328
1,1,1,4,4,4-hexafluoro-2-[trifluoromethylsulfonyl(3,3,3-trifluoropropylsulfonyl)methyl]sulfonylbutane (PubChem CID 59584328) has the molecular formula C9H7F12O6S3- and a molecular weight of 535.33 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluoro-2-[trifluoromethylsulfonyl(3,3,3-trifluoropropylsulfonyl)methyl]sulfonylbutane.
| Compound Name | 1,1,1,4,4,4-hexafluoro-2-[trifluoromethylsulfonyl(3,3,3-trifluoropropylsulfonyl)methyl]sulfonylbutane |
|---|---|
| PubChem CID | 59584328 |
| Molecular Formula | C9H7F12O6S3- |
| Molecular Weight | 535.33 g/mol |
| Exact Mass | 534.92 |
| IUPAC Name | 1,1,1,4,4,4-hexafluoro-2-[trifluoromethylsulfonyl(3,3,3-trifluoropropylsulfonyl)methyl]sulfonylbutane |
| SMILES | O=S(=O)(CCC(F)(F)F)[C-](S(=O)(=O)C(CC(F)(F)F)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H7F12O6S3/c10-6(11,12)1-2-28(22,23)5(30(26,27)9(19,20)21)29(24,25)4(8(16,17)18)3-7(13,14)15/h4H,1-3H2/q-1 |
| InChIKey | SNRCKSBPWTWEFF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|