C17H3F19O4S2 — CID 59584341
1,2,3,4,5,6,8-heptafluoro-7-[[3,3,3-trifluoro-2,2-bis(trifluoromethyl)propyl]sulfonyl-(trifluoromethylsulfonyl)methyl]naphthalene (PubChem CID 59584341) has the molecular formula C17H3F19O4S2 and a molecular weight of 696.30 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptafluoro-7-[[3,3,3-trifluoro-2,2-bis(trifluoromethyl)propyl]sulfonyl-(trifluoromethylsulfonyl)methyl]naphthalene.
| Compound Name | 1,2,3,4,5,6,8-heptafluoro-7-[[3,3,3-trifluoro-2,2-bis(trifluoromethyl)propyl]sulfonyl-(trifluoromethylsulfonyl)methyl]naphthalene |
|---|---|
| PubChem CID | 59584341 |
| Molecular Formula | C17H3F19O4S2 |
| Molecular Weight | 696.30 g/mol |
| Exact Mass | 695.92 |
| IUPAC Name | 1,2,3,4,5,6,8-heptafluoro-7-[[3,3,3-trifluoro-2,2-bis(trifluoromethyl)propyl]sulfonyl-(trifluoromethylsulfonyl)methyl]naphthalene |
| SMILES | O=S(=O)(CC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)C(c1c(F)c(F)c2c(F)c(F)c(F)c(F)c2c1F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C17H3F19O4S2/c18-5-2-3(8(21)11(24)10(23)7(2)20)6(19)9(22)4(5)12(42(39,40)17(34,35)36)41(37,38)1-13(14(25,26)27,15(28,29)30)16(31,32)33/h12H,1H2 |
| InChIKey | NPFGXGQHBUTYAV-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.30 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|