C14H18F6O6S3 — CID 59584373
1-fluoro-3-[methylsulfonyl(1,1,2,2,2-pentafluoroethylsulfonyl)methyl]sulfonyladamantane (PubChem CID 59584373) has the molecular formula C14H18F6O6S3 and a molecular weight of 492.48 g/mol. Its IUPAC name is 1-fluoro-3-[methylsulfonyl(1,1,2,2,2-pentafluoroethylsulfonyl)methyl]sulfonyladamantane.
| Compound Name | 1-fluoro-3-[methylsulfonyl(1,1,2,2,2-pentafluoroethylsulfonyl)methyl]sulfonyladamantane |
|---|---|
| PubChem CID | 59584373 |
| Molecular Formula | C14H18F6O6S3 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | 1-fluoro-3-[methylsulfonyl(1,1,2,2,2-pentafluoroethylsulfonyl)methyl]sulfonyladamantane |
| SMILES | CS(=O)(=O)C(S(=O)(=O)C12CC3CC(CC(F)(C3)C1)C2)S(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H18F6O6S3/c1-27(21,22)10(29(25,26)14(19,20)13(16,17)18)28(23,24)12-5-8-2-9(6-12)4-11(15,3-8)7-12/h8-10H,2-7H2,1H3 |
| InChIKey | KCVCUTXYLKVUJZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|