About (2,5-dioxopyrrolidin-1-yl) (E)-3-[4,5-bis(hydroxymethyl)-2-nitrophenyl]prop-2-enoate
(2,5-dioxopyrrolidin-1-yl) (E)-3-[4,5-bis(hydroxymethyl)-2-nitrophenyl]prop-2-enoate (PubChem CID 59584448) has the molecular formula C15H14N2O8
and a molecular weight of 350.28 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (E)-3-[4,5-bis(hydroxymethyl)-2-nitrophenyl]prop-2-enoate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (E)-3-[4,5-bis(hydroxymethyl)-2-nitrophenyl]prop-2-enoate |
| PubChem CID | 59584448 |
| Molecular Formula | C15H14N2O8 |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (E)-3-[4,5-bis(hydroxymethyl)-2-nitrophenyl]prop-2-enoate |
| SMILES | O=C(/C=C/c1cc(CO)c(CO)cc1[N+](=O)[O-])ON1C(=O)CCC1=O |
| InChI | InChI=1S/C15H14N2O8/c18-7-10-5-9(12(17(23)24)6-11(10)8-19)1-4-15(22)25-16-13(20)2-3-14(16)21/h1,4-6,18-19H,2-3,7-8H2/b4-1+ |
| InChIKey | VDWAXACXLPMOKJ-DAFODLJHSA-N |
| XLogP | 0.20 |
| TPSA | 147.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) (E)-3-[4,5-bis(hydroxymethyl)-2-nitrophenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) (E)-3-[4,5-bis(hydroxymethyl)-2-nitrophenyl]prop-2-enoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) (E)-3-[4,5-bis(hydroxymethyl)-2-nitrophenyl]prop-2-enoate (CID 59584448) is (2,5-dioxopyrrolidin-1-yl) (E)-3-[4,5-bis(hydroxymethyl)-2-nitrophenyl]prop-2-enoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) (E)-3-[4,5-bis(hydroxymethyl)-2-nitrophenyl]prop-2-enoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) (E)-3-[4,5-bis(hydroxymethyl)-2-nitrophenyl]prop-2-enoate is O=C(/C=C/c1cc(CO)c(CO)cc1[N+](=O)[O-])ON1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) (E)-3-[4,5-bis(hydroxymethyl)-2-nitrophenyl]prop-2-enoate?
The InChIKey is VDWAXACXLPMOKJ-DAFODLJHSA-N. The full InChI is InChI=1S/C15H14N2O8/c18-7-10-5-9(12(17(23)24)6-11(10)8-19)1-4-15(22)25-16-13(20)2-3-14(16)21/h1,4-6,18-19H,2-3,7-8H2/b4-1+.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) (E)-3-[4,5-bis(hydroxymethyl)-2-nitrophenyl]prop-2-enoate?
(2,5-dioxopyrrolidin-1-yl) (E)-3-[4,5-bis(hydroxymethyl)-2-nitrophenyl]prop-2-enoate has a molecular weight of 350.28 g/mol, XLogP of 0.20, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) (E)-3-[4,5-bis(hydroxymethyl)-2-nitrophenyl]prop-2-enoate is sourced from PubChem (CID 59584448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).