C17H34N2O3 — CID 59584580
4,5-diethyl-4,5-dimethyl-1,3-bis(propoxymethyl)imidazolidin-2-one (PubChem CID 59584580) has the molecular formula C17H34N2O3 and a molecular weight of 314.47 g/mol. Its IUPAC name is 4,5-diethyl-4,5-dimethyl-1,3-bis(propoxymethyl)imidazolidin-2-one.
| Compound Name | 4,5-diethyl-4,5-dimethyl-1,3-bis(propoxymethyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 59584580 |
| Molecular Formula | C17H34N2O3 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | 4,5-diethyl-4,5-dimethyl-1,3-bis(propoxymethyl)imidazolidin-2-one |
| SMILES | CCCOCN1C(=O)N(COCCC)C(C)(CC)C1(C)CC |
| InChI | InChI=1S/C17H34N2O3/c1-7-11-21-13-18-15(20)19(14-22-12-8-2)17(6,10-4)16(18,5)9-3/h7-14H2,1-6H3 |
| InChIKey | SMBNEHFWCASVGW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|