C21H20ClNO3S — CID 59584608
(1R,2S,6R,7R)-4-[2-(4-chlorophenyl)-5-ethyl-1,3-thiazol-4-yl]-1-methyl-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 59584608) has the molecular formula C21H20ClNO3S and a molecular weight of 401.92 g/mol. Its IUPAC name is (1R,2S,6R,7R)-4-[2-(4-chlorophenyl)-5-ethyl-1,3-thiazol-4-yl]-1-methyl-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6R,7R)-4-[2-(4-chlorophenyl)-5-ethyl-1,3-thiazol-4-yl]-1-methyl-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 59584608 |
| Molecular Formula | C21H20ClNO3S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | (1R,2S,6R,7R)-4-[2-(4-chlorophenyl)-5-ethyl-1,3-thiazol-4-yl]-1-methyl-10-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CCc1sc(-c2ccc(Cl)cc2)nc1C1C(=O)[C@H]2[C@H]3CC[C@@](C)(O3)[C@H]2C1=O |
| InChI | InChI=1S/C21H20ClNO3S/c1-3-13-17(23-20(27-13)10-4-6-11(22)7-5-10)15-18(24)14-12-8-9-21(2,26-12)16(14)19(15)25/h4-7,12,14-16H,3,8-9H2,1-2H3/t12-,14+,15?,16-,21-/m1/s1 |
| InChIKey | TXCWNPBERMFBHR-ROQPRFANSA-N |
| XLogP | 4.45 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|