C6H11NO — CID 59584699
(5S,6S)-5,6-dimethyl-5,6-dihydro-4H-1,3-oxazine (PubChem CID 59584699) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is (5S,6S)-5,6-dimethyl-5,6-dihydro-4H-1,3-oxazine.
| Compound Name | (5S,6S)-5,6-dimethyl-5,6-dihydro-4H-1,3-oxazine |
|---|---|
| PubChem CID | 59584699 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | (5S,6S)-5,6-dimethyl-5,6-dihydro-4H-1,3-oxazine |
| SMILES | C[C@@H]1OC=NC[C@@H]1C |
| InChI | InChI=1S/C6H11NO/c1-5-3-7-4-8-6(5)2/h4-6H,3H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | DEJACQPVBQBAKP-WDSKDSINSA-N |
| XLogP | 1.07 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |