C6H11N — CID 59584722
(3R,4S)-3,4-dimethyl-3,4-dihydro-2H-pyrrole (PubChem CID 59584722) has the molecular formula C6H11N and a molecular weight of 97.16 g/mol. Its IUPAC name is (3R,4S)-3,4-dimethyl-3,4-dihydro-2H-pyrrole.
| Compound Name | (3R,4S)-3,4-dimethyl-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 59584722 |
| Molecular Formula | C6H11N |
| Molecular Weight | 97.16 g/mol |
| Exact Mass | 97.09 |
| IUPAC Name | (3R,4S)-3,4-dimethyl-3,4-dihydro-2H-pyrrole |
| SMILES | C[C@@H]1C=NC[C@@H]1C |
| InChI | InChI=1S/C6H11N/c1-5-3-7-4-6(5)2/h3,5-6H,4H2,1-2H3/t5-,6+/m1/s1 |
| InChIKey | TYBBSFCJIOKPBK-RITPCOANSA-N |
| XLogP | 1.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 97.16 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |