C25H34O7S — CID 59585092
[(2S,3S,4S,5R,6S)-6-(3-hydroxypropoxy)-3,4-dimethyl-5-phenylmethoxyoxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 59585092) has the molecular formula C25H34O7S and a molecular weight of 478.61 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-6-(3-hydroxypropoxy)-3,4-dimethyl-5-phenylmethoxyoxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S,4S,5R,6S)-6-(3-hydroxypropoxy)-3,4-dimethyl-5-phenylmethoxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59585092 |
| Molecular Formula | C25H34O7S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-6-(3-hydroxypropoxy)-3,4-dimethyl-5-phenylmethoxyoxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2O[C@H](OCCCO)[C@H](OCc3ccccc3)[C@@H](C)[C@@H]2C)cc1 |
| InChI | InChI=1S/C25H34O7S/c1-18-10-12-22(13-11-18)33(27,28)31-17-23-19(2)20(3)24(25(32-23)29-15-7-14-26)30-16-21-8-5-4-6-9-21/h4-6,8-13,19-20,23-26H,7,14-17H2,1-3H3/t19-,20-,23+,24+,25-/m0/s1 |
| InChIKey | WSAWUDSYFFMERZ-FZSWRXECSA-N |
| XLogP | 3.68 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|