C7H6F7N3 — CID 59585176
5-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-dimethyl-1,2,4-triazole (PubChem CID 59585176) has the molecular formula C7H6F7N3 and a molecular weight of 265.13 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-dimethyl-1,2,4-triazole.
| Compound Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 59585176 |
| Molecular Formula | C7H6F7N3 |
| Molecular Weight | 265.13 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-dimethyl-1,2,4-triazole |
| SMILES | Cc1nc(C(F)(F)C(F)(F)C(F)(F)F)n(C)n1 |
| InChI | InChI=1S/C7H6F7N3/c1-3-15-4(17(2)16-3)5(8,9)6(10,11)7(12,13)14/h1-2H3 |
| InChIKey | ZOFHWLHIUTTWGZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.13 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|