About 3-methylpyran-4-thione
3-methylpyran-4-thione (PubChem CID 59585190) has the molecular formula C6H6OS
and a molecular weight of 126.18 g/mol. Its IUPAC name is 3-methylpyran-4-thione.
Molecular Properties
| Compound Name | 3-methylpyran-4-thione |
| PubChem CID | 59585190 |
| Molecular Formula | C6H6OS |
| Molecular Weight | 126.18 g/mol |
| Exact Mass | 126.01 |
| IUPAC Name | 3-methylpyran-4-thione |
| SMILES | Cc1coccc1=S |
| InChI | InChI=1S/C6H6OS/c1-5-4-7-3-2-6(5)8/h2-4H,1H3 |
| InChIKey | VOOXXMPRZVUBHN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-methylpyran-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpyran-4-thione?
The IUPAC name of 3-methylpyran-4-thione (CID 59585190) is 3-methylpyran-4-thione.
What is the SMILES notation for 3-methylpyran-4-thione?
The canonical SMILES for 3-methylpyran-4-thione is Cc1coccc1=S.
What is the InChIKey of 3-methylpyran-4-thione?
The InChIKey is VOOXXMPRZVUBHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6OS/c1-5-4-7-3-2-6(5)8/h2-4H,1H3.
What are the key properties of 3-methylpyran-4-thione?
3-methylpyran-4-thione has a molecular weight of 126.18 g/mol, XLogP of 2.32, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpyran-4-thione is sourced from PubChem (CID 59585190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).