C17H21N2O5P — CID 59585236
methyl-[[3-[[[(1S)-1-pyridin-3-ylethoxy]carbonylamino]methyl]phenoxy]methyl]phosphinic acid (PubChem CID 59585236) has the molecular formula C17H21N2O5P and a molecular weight of 364.34 g/mol. Its IUPAC name is methyl-[[3-[[[(1S)-1-pyridin-3-ylethoxy]carbonylamino]methyl]phenoxy]methyl]phosphinic acid.
| Compound Name | methyl-[[3-[[[(1S)-1-pyridin-3-ylethoxy]carbonylamino]methyl]phenoxy]methyl]phosphinic acid |
|---|---|
| PubChem CID | 59585236 |
| Molecular Formula | C17H21N2O5P |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | methyl-[[3-[[[(1S)-1-pyridin-3-ylethoxy]carbonylamino]methyl]phenoxy]methyl]phosphinic acid |
| SMILES | C[C@H](OC(=O)NCc1cccc(OCP(C)(=O)O)c1)c1cccnc1 |
| InChI | InChI=1S/C17H21N2O5P/c1-13(15-6-4-8-18-11-15)24-17(20)19-10-14-5-3-7-16(9-14)23-12-25(2,21)22/h3-9,11,13H,10,12H2,1-2H3,(H,19,20)(H,21,22)/t13-/m0/s1 |
| InChIKey | AQSWRLDYQHUPSL-ZDUSSCGKSA-N |
| XLogP | 3.31 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|