C24H27N2O11P — CID 59585344
(3aR,4R,6S,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7-(3,4-dinitrophenoxy)-2,2-dimethyl-6-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinine 6-oxide (PubChem CID 59585344) has the molecular formula C24H27N2O11P and a molecular weight of 550.46 g/mol. Its IUPAC name is (3aR,4R,6S,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7-(3,4-dinitrophenoxy)-2,2-dimethyl-6-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinine 6-oxide.
| Compound Name | (3aR,4R,6S,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7-(3,4-dinitrophenoxy)-2,2-dimethyl-6-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinine 6-oxide |
|---|---|
| PubChem CID | 59585344 |
| Molecular Formula | C24H27N2O11P |
| Molecular Weight | 550.46 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | (3aR,4R,6S,7R,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7-(3,4-dinitrophenoxy)-2,2-dimethyl-6-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-d]oxaphosphinine 6-oxide |
| SMILES | CC1(C)O[C@H]2[C@@H]([C@H]3COC(C)(C)O3)O[P@@](=O)(c3ccccc3)[C@@H](Oc3ccc([N+](=O)[O-])c([N+](=O)[O-])c3)[C@H]2O1 |
| InChI | InChI=1S/C24H27N2O11P/c1-23(2)32-13-18(34-23)19-20-21(36-24(3,4)35-20)22(38(31,37-19)15-8-6-5-7-9-15)33-14-10-11-16(25(27)28)17(12-14)26(29)30/h5-12,18-22H,13H2,1-4H3/t18-,19-,20+,21+,22-,38+/m1/s1 |
| InChIKey | JDPPBAVDMURBSO-ZPNLHDGJSA-N |
| XLogP | 3.88 |
| TPSA | 158.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|