C24H22Cl2N4O2 — CID 59585409
3-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)phenyl]-2-oxoethyl]-5-methylbenzamide (PubChem CID 59585409) has the molecular formula C24H22Cl2N4O2 and a molecular weight of 469.37 g/mol. Its IUPAC name is 3-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)phenyl]-2-oxoethyl]-5-methylbenzamide.
| Compound Name | 3-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)phenyl]-2-oxoethyl]-5-methylbenzamide |
|---|---|
| PubChem CID | 59585409 |
| Molecular Formula | C24H22Cl2N4O2 |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 3-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)phenyl]-2-oxoethyl]-5-methylbenzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Cc2c(Cl)cc(C)cc2C(=O)Nc2ccc(Cl)cn2)cc1)N(C)C |
| InChI | InChI=1S/C24H22Cl2N4O2/c1-14-10-19(24(32)29-22-9-8-17(25)13-28-22)18(20(26)11-14)12-21(31)15-4-6-16(7-5-15)23(27)30(2)3/h4-11,13,27H,12H2,1-3H3,(H,28,29,32)/b27-23- |
| InChIKey | JGRNQZWYFRYVHP-VYIQYICTSA-N |
| XLogP | 5.26 |
| TPSA | 86.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|