C27H26ClFN4O2 — CID 59585411
N-(5-chloro-2-pyridinyl)-2-[2-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-2-oxoethyl]-5-methylbenzamide (PubChem CID 59585411) has the molecular formula C27H26ClFN4O2 and a molecular weight of 492.98 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[2-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-2-oxoethyl]-5-methylbenzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[2-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-2-oxoethyl]-5-methylbenzamide |
|---|---|
| PubChem CID | 59585411 |
| Molecular Formula | C27H26ClFN4O2 |
| Molecular Weight | 492.98 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[2-[2-fluoro-4-(piperidine-1-carboximidoyl)phenyl]-2-oxoethyl]-5-methylbenzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Cc2ccc(C)cc2C(=O)Nc2ccc(Cl)cn2)c(F)c1)N1CCCCC1 |
| InChI | InChI=1S/C27H26ClFN4O2/c1-17-5-6-18(22(13-17)27(35)32-25-10-8-20(28)16-31-25)15-24(34)21-9-7-19(14-23(21)29)26(30)33-11-3-2-4-12-33/h5-10,13-14,16,30H,2-4,11-12,15H2,1H3,(H,31,32,35)/b30-26- |
| InChIKey | YDNQOFASLHJFAP-BXVZCJGGSA-N |
| XLogP | 5.67 |
| TPSA | 86.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.98 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|