C23H21BrN4O2 — CID 59585419
N-(5-bromo-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)phenyl]-2-oxoethyl]benzamide (PubChem CID 59585419) has the molecular formula C23H21BrN4O2 and a molecular weight of 465.35 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)phenyl]-2-oxoethyl]benzamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)phenyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 59585419 |
| Molecular Formula | C23H21BrN4O2 |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)phenyl]-2-oxoethyl]benzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Cc2ccccc2C(=O)Nc2ccc(Br)cn2)cc1)N(C)C |
| InChI | InChI=1S/C23H21BrN4O2/c1-28(2)22(25)16-9-7-15(8-10-16)20(29)13-17-5-3-4-6-19(17)23(30)27-21-12-11-18(24)14-26-21/h3-12,14,25H,13H2,1-2H3,(H,26,27,30)/b25-22- |
| InChIKey | GOJBJKHSJJGJJY-LVWGJNHUSA-N |
| XLogP | 4.41 |
| TPSA | 86.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|