C21H17BrN4O2 — CID 59585438
N-(5-bromo-2-pyridinyl)-2-[2-(4-carbamimidoylphenyl)-2-oxoethyl]benzamide (PubChem CID 59585438) has the molecular formula C21H17BrN4O2 and a molecular weight of 437.30 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-2-[2-(4-carbamimidoylphenyl)-2-oxoethyl]benzamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-2-[2-(4-carbamimidoylphenyl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 59585438 |
| Molecular Formula | C21H17BrN4O2 |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-2-[2-(4-carbamimidoylphenyl)-2-oxoethyl]benzamide |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)Cc2ccccc2C(=O)Nc2ccc(Br)cn2)cc1 |
| InChI | InChI=1S/C21H17BrN4O2/c22-16-9-10-19(25-12-16)26-21(28)17-4-2-1-3-15(17)11-18(27)13-5-7-14(8-6-13)20(23)24/h1-10,12H,11H2,(H3,23,24)(H,25,26,28) |
| InChIKey | VPUYWCIJAKOPEZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|