C23H19Cl2FN4O2 — CID 59585484
5-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]-2-oxoethyl]benzamide (PubChem CID 59585484) has the molecular formula C23H19Cl2FN4O2 and a molecular weight of 473.34 g/mol. Its IUPAC name is 5-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]-2-oxoethyl]benzamide.
| Compound Name | 5-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 59585484 |
| Molecular Formula | C23H19Cl2FN4O2 |
| Molecular Weight | 473.34 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 5-chloro-N-(5-chloro-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)-2-fluorophenyl]-2-oxoethyl]benzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Cc2ccc(Cl)cc2C(=O)Nc2ccc(Cl)cn2)c(F)c1)N(C)C |
| InChI | InChI=1S/C23H19Cl2FN4O2/c1-30(2)22(27)14-4-7-17(19(26)9-14)20(31)10-13-3-5-15(24)11-18(13)23(32)29-21-8-6-16(25)12-28-21/h3-9,11-12,27H,10H2,1-2H3,(H,28,29,32)/b27-22- |
| InChIKey | LWSYFKVYSQVDCQ-QYQHSDTDSA-N |
| XLogP | 5.09 |
| TPSA | 86.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.34 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|