C6H5N5O — CID 595859
1-oxidopyrido[4,3-e][1,2,4]triazin-1-ium-3-amine (PubChem CID 595859) has the molecular formula C6H5N5O and a molecular weight of 163.14 g/mol. Its IUPAC name is 1-oxidopyrido[4,3-e][1,2,4]triazin-1-ium-3-amine.
| Compound Name | 1-oxidopyrido[4,3-e][1,2,4]triazin-1-ium-3-amine |
|---|---|
| PubChem CID | 595859 |
| Molecular Formula | C6H5N5O |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 1-oxidopyrido[4,3-e][1,2,4]triazin-1-ium-3-amine |
| SMILES | Nc1nc2ccncc2[n+]([O-])n1 |
| InChI | InChI=1S/C6H5N5O/c7-6-9-4-1-2-8-3-5(4)11(12)10-6/h1-3H,(H2,7,9,10) |
| InChIKey | AQCOIRPPANXREI-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 91.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|