About 2-ethyl-4-methyl-3a,4-dihydro-1H-benzimidazole
2-ethyl-4-methyl-3a,4-dihydro-1H-benzimidazole (PubChem CID 59585993) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-ethyl-4-methyl-3a,4-dihydro-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-ethyl-4-methyl-3a,4-dihydro-1H-benzimidazole |
| PubChem CID | 59585993 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-ethyl-4-methyl-3a,4-dihydro-1H-benzimidazole |
| SMILES | CCC1=NC2C(=CC=CC2C)N1 |
| InChI | InChI=1S/C10H14N2/c1-3-9-11-8-6-4-5-7(2)10(8)12-9/h4-7,10H,3H2,1-2H3,(H,11,12) |
| InChIKey | QSFOLXRECKMOAL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-4-methyl-3a,4-dihydro-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-methyl-3a,4-dihydro-1H-benzimidazole?
The IUPAC name of 2-ethyl-4-methyl-3a,4-dihydro-1H-benzimidazole (CID 59585993) is 2-ethyl-4-methyl-3a,4-dihydro-1H-benzimidazole.
What is the SMILES notation for 2-ethyl-4-methyl-3a,4-dihydro-1H-benzimidazole?
The canonical SMILES for 2-ethyl-4-methyl-3a,4-dihydro-1H-benzimidazole is CCC1=NC2C(=CC=CC2C)N1.
What is the InChIKey of 2-ethyl-4-methyl-3a,4-dihydro-1H-benzimidazole?
The InChIKey is QSFOLXRECKMOAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-3-9-11-8-6-4-5-7(2)10(8)12-9/h4-7,10H,3H2,1-2H3,(H,11,12).
What are the key properties of 2-ethyl-4-methyl-3a,4-dihydro-1H-benzimidazole?
2-ethyl-4-methyl-3a,4-dihydro-1H-benzimidazole has a molecular weight of 162.24 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-methyl-3a,4-dihydro-1H-benzimidazole is sourced from PubChem (CID 59585993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).