C29H35N7O3S — CID 59586160
3-[[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]sulfonyl]-5-[4-[(7S)-7-ethyl-5,6,7,8-tetrahydroquinazolin-4-yl]-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]pyridin-2-amine (PubChem CID 59586160) has the molecular formula C29H35N7O3S and a molecular weight of 561.71 g/mol. Its IUPAC name is 3-[[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]sulfonyl]-5-[4-[(7S)-7-ethyl-5,6,7,8-tetrahydroquinazolin-4-yl]-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]pyridin-2-amine.
| Compound Name | 3-[[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]sulfonyl]-5-[4-[(7S)-7-ethyl-5,6,7,8-tetrahydroquinazolin-4-yl]-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 59586160 |
| Molecular Formula | C29H35N7O3S |
| Molecular Weight | 561.71 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 3-[[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]sulfonyl]-5-[4-[(7S)-7-ethyl-5,6,7,8-tetrahydroquinazolin-4-yl]-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]pyridin-2-amine |
| SMILES | CC[C@H]1CCc2c(ncnc2N2CCOc3ccc(-c4cnc(N)c(S(=O)(=O)N5C[C@@H]6C[C@H]5CN6)c4)cc3C2)C1 |
| InChI | InChI=1S/C29H35N7O3S/c1-2-18-3-5-24-25(9-18)33-17-34-29(24)35-7-8-39-26-6-4-19(10-21(26)15-35)20-11-27(28(30)32-13-20)40(37,38)36-16-22-12-23(36)14-31-22/h4,6,10-11,13,17-18,22-23,31H,2-3,5,7-9,12,14-16H2,1H3,(H2,30,32)/t18-,22-,23-/m0/s1 |
| InChIKey | HGJPGFSLQAGAPB-TZYHBYERSA-N |
| XLogP | 2.77 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.71 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |